C14H30N4O9 — CID 144974159
(2R,3S,4R,5R)-1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]hexane-1,2,3,4,5,6-hexol (PubChem CID 144974159) has the molecular formula C14H30N4O9 and a molecular weight of 398.41 g/mol. Its IUPAC name is (2R,3S,4R,5R)-1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3S,4R,5R)-1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 144974159 |
| Molecular Formula | C14H30N4O9 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (2R,3S,4R,5R)-1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]hexane-1,2,3,4,5,6-hexol |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H30N4O9/c15-18-17-2-4-26-6-8-27-7-5-25-3-1-16-14(24)13(23)12(22)11(21)10(20)9-19/h10-14,16,19-24H,1-9H2/t10-,11-,12+,13-,14?/m1/s1 |
| InChIKey | RAOZLEABMMRMAR-RQICVUQASA-N |
| XLogP | -3.31 |
| TPSA | 209.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|