C33H47N7O8 — CID 59482978
2-[[2-[[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-2-oxoethoxy]acetyl]amino]-3-phenylpropanoyl]amino]-N-[4-(hydroxymethyl)phenyl]heptanamide (PubChem CID 59482978) has the molecular formula C33H47N7O8 and a molecular weight of 669.78 g/mol. Its IUPAC name is 2-[[2-[[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-2-oxoethoxy]acetyl]amino]-3-phenylpropanoyl]amino]-N-[4-(hydroxymethyl)phenyl]heptanamide.
| Compound Name | 2-[[2-[[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-2-oxoethoxy]acetyl]amino]-3-phenylpropanoyl]amino]-N-[4-(hydroxymethyl)phenyl]heptanamide |
|---|---|
| PubChem CID | 59482978 |
| Molecular Formula | C33H47N7O8 |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.35 |
| IUPAC Name | 2-[[2-[[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-2-oxoethoxy]acetyl]amino]-3-phenylpropanoyl]amino]-N-[4-(hydroxymethyl)phenyl]heptanamide |
| SMILES | CCCCCC(NC(=O)C(Cc1ccccc1)NC(=O)COCC(=O)NCCOCCOCCN=[N+]=[N-])C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C33H47N7O8/c1-2-3-5-10-28(32(44)37-27-13-11-26(22-41)12-14-27)39-33(45)29(21-25-8-6-4-7-9-25)38-31(43)24-48-23-30(42)35-15-17-46-19-20-47-18-16-36-40-34/h4,6-9,11-14,28-29,41H,2-3,5,10,15-24H2,1H3,(H,35,42)(H,37,44)(H,38,43)(H,39,45) |
| InChIKey | XDWGOLWOQBMNTN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 213.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|