C17H32BrNO3 — CID 165489760
tert-butyl N-[3-bromo-2-[(2-tert-butylcyclopropyl)methoxy]-2-methylpropyl]carbamate (PubChem CID 165489760) has the molecular formula C17H32BrNO3 and a molecular weight of 378.35 g/mol. Its IUPAC name is tert-butyl N-[3-bromo-2-[(2-tert-butylcyclopropyl)methoxy]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-bromo-2-[(2-tert-butylcyclopropyl)methoxy]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 165489760 |
| Molecular Formula | C17H32BrNO3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | tert-butyl N-[3-bromo-2-[(2-tert-butylcyclopropyl)methoxy]-2-methylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(CBr)OCC1CC1C(C)(C)C |
| InChI | InChI=1S/C17H32BrNO3/c1-15(2,3)13-8-12(13)9-21-17(7,10-18)11-19-14(20)22-16(4,5)6/h12-13H,8-11H2,1-7H3,(H,19,20) |
| InChIKey | PCGPBTBTZOOYAC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|