C16H23BrFNO3 — CID 104969698
tert-butyl N-[3-bromo-2-[(2-fluorophenyl)methoxy]-2-methylpropyl]carbamate (PubChem CID 104969698) has the molecular formula C16H23BrFNO3 and a molecular weight of 376.27 g/mol. Its IUPAC name is tert-butyl N-[3-bromo-2-[(2-fluorophenyl)methoxy]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-bromo-2-[(2-fluorophenyl)methoxy]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 104969698 |
| Molecular Formula | C16H23BrFNO3 |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | tert-butyl N-[3-bromo-2-[(2-fluorophenyl)methoxy]-2-methylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(CBr)OCc1ccccc1F |
| InChI | InChI=1S/C16H23BrFNO3/c1-15(2,3)22-14(20)19-11-16(4,10-17)21-9-12-7-5-6-8-13(12)18/h5-8H,9-11H2,1-4H3,(H,19,20) |
| InChIKey | DKKHSEFZAWXIDK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|