C16H22FNO3 — CID 84730984
tert-butyl N-[2-[(2-fluorophenyl)methyl]-2-methyl-3-oxopropyl]carbamate (PubChem CID 84730984) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-fluorophenyl)methyl]-2-methyl-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-fluorophenyl)methyl]-2-methyl-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 84730984 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | tert-butyl N-[2-[(2-fluorophenyl)methyl]-2-methyl-3-oxopropyl]carbamate |
| SMILES | CC(C=O)(CNC(=O)OC(C)(C)C)Cc1ccccc1F |
| InChI | InChI=1S/C16H22FNO3/c1-15(2,3)21-14(20)18-10-16(4,11-19)9-12-7-5-6-8-13(12)17/h5-8,11H,9-10H2,1-4H3,(H,18,20) |
| InChIKey | BCGMJFTXWZKQHC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|