C15H23FN2O4S — CID 113066925
tert-butyl N-[2-[(2-fluorophenyl)methyl-methylsulfonylamino]ethyl]carbamate (PubChem CID 113066925) has the molecular formula C15H23FN2O4S and a molecular weight of 346.42 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-fluorophenyl)methyl-methylsulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-fluorophenyl)methyl-methylsulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 113066925 |
| Molecular Formula | C15H23FN2O4S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | tert-butyl N-[2-[(2-fluorophenyl)methyl-methylsulfonylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(Cc1ccccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C15H23FN2O4S/c1-15(2,3)22-14(19)17-9-10-18(23(4,20)21)11-12-7-5-6-8-13(12)16/h5-8H,9-11H2,1-4H3,(H,17,19) |
| InChIKey | ZYNKUKQSVGFUOW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |