C18H34N2O7 — CID 131998982
2-[[2-methyl-2-(2-methylpropoxy)propyl]carbamoyloxy]ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 131998982) has the molecular formula C18H34N2O7 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-[[2-methyl-2-(2-methylpropoxy)propyl]carbamoyloxy]ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | 2-[[2-methyl-2-(2-methylpropoxy)propyl]carbamoyloxy]ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 131998982 |
| Molecular Formula | C18H34N2O7 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-[[2-methyl-2-(2-methylpropoxy)propyl]carbamoyloxy]ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC(C)COC(C)(C)CNC(=O)OCCOC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H34N2O7/c1-13(2)11-26-18(6,7)12-20-15(22)25-9-8-24-14(21)10-19-16(23)27-17(3,4)5/h13H,8-12H2,1-7H3,(H,19,23)(H,20,22) |
| InChIKey | YEONTWDEWKHCCP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|