C13H27NO3S — CID 123396526
tert-butyl N-[2-methyl-2-(2-methyl-2-sulfanylpropoxy)propyl]carbamate (PubChem CID 123396526) has the molecular formula C13H27NO3S and a molecular weight of 277.43 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-2-(2-methyl-2-sulfanylpropoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-2-(2-methyl-2-sulfanylpropoxy)propyl]carbamate |
|---|---|
| PubChem CID | 123396526 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | tert-butyl N-[2-methyl-2-(2-methyl-2-sulfanylpropoxy)propyl]carbamate |
| SMILES | CC(C)(S)COC(C)(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H27NO3S/c1-11(2,3)17-10(15)14-8-12(4,5)16-9-13(6,7)18/h18H,8-9H2,1-7H3,(H,14,15) |
| InChIKey | OBWKXPQVPOVSRF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|