C13H27NO9S2 — CID 175192046
2-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]oxyethyl methylsulfonyloxymethanesulfonate (PubChem CID 175192046) has the molecular formula C13H27NO9S2 and a molecular weight of 405.49 g/mol. Its IUPAC name is 2-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]oxyethyl methylsulfonyloxymethanesulfonate.
| Compound Name | 2-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]oxyethyl methylsulfonyloxymethanesulfonate |
|---|---|
| PubChem CID | 175192046 |
| Molecular Formula | C13H27NO9S2 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-[2-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]oxyethyl methylsulfonyloxymethanesulfonate |
| SMILES | CC(C)(C)OC(=O)NCC(C)(C)OCCOS(=O)(=O)COS(C)(=O)=O |
| InChI | InChI=1S/C13H27NO9S2/c1-12(2,3)23-11(15)14-9-13(4,5)20-7-8-21-25(18,19)10-22-24(6,16)17/h7-10H2,1-6H3,(H,14,15) |
| InChIKey | RTRFYJPWCYQNIW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|