C15H31NO8S — CID 163276223
3-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]propyl methanesulfonate (PubChem CID 163276223) has the molecular formula C15H31NO8S and a molecular weight of 385.48 g/mol. Its IUPAC name is 3-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]propyl methanesulfonate.
| Compound Name | 3-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]propyl methanesulfonate |
|---|---|
| PubChem CID | 163276223 |
| Molecular Formula | C15H31NO8S |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 3-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]propyl methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCCOS(C)(=O)=O |
| InChI | InChI=1S/C15H31NO8S/c1-15(2,3)24-14(17)16-6-9-21-11-13-22-12-10-20-7-5-8-23-25(4,18)19/h5-13H2,1-4H3,(H,16,17) |
| InChIKey | JCQISJQAHBILLK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|