C22H38OSi — CID 154712103
tert-butyl-[(E,2S,5S)-5-cyclohepta-2,4,6-trien-1-yl-2,5-dimethylhept-3-enoxy]-dimethylsilane (PubChem CID 154712103) has the molecular formula C22H38OSi and a molecular weight of 346.63 g/mol. Its IUPAC name is tert-butyl-[(E,2S,5S)-5-cyclohepta-2,4,6-trien-1-yl-2,5-dimethylhept-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,2S,5S)-5-cyclohepta-2,4,6-trien-1-yl-2,5-dimethylhept-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 154712103 |
| Molecular Formula | C22H38OSi |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | tert-butyl-[(E,2S,5S)-5-cyclohepta-2,4,6-trien-1-yl-2,5-dimethylhept-3-enoxy]-dimethylsilane |
| SMILES | CC[C@@](C)(/C=C/[C@H](C)CO[Si](C)(C)C(C)(C)C)C1C=CC=CC=C1 |
| InChI | InChI=1S/C22H38OSi/c1-9-22(6,20-14-12-10-11-13-15-20)17-16-19(2)18-23-24(7,8)21(3,4)5/h10-17,19-20H,9,18H2,1-8H3/b17-16+/t19-,22-/m0/s1 |
| InChIKey | WRDSMSAZOMHDPI-VXYMMBQASA-N |
| XLogP | 6.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|