C18H30O3SSi — CID 10473349
ethyl 5-[(E,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-1-enyl]thiophene-2-carboxylate (PubChem CID 10473349) has the molecular formula C18H30O3SSi and a molecular weight of 354.59 g/mol. Its IUPAC name is ethyl 5-[(E,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-1-enyl]thiophene-2-carboxylate.
| Compound Name | ethyl 5-[(E,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-1-enyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 10473349 |
| Molecular Formula | C18H30O3SSi |
| Molecular Weight | 354.59 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | ethyl 5-[(E,3R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-1-enyl]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(/C=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C)s1 |
| InChI | InChI=1S/C18H30O3SSi/c1-8-20-17(19)16-12-11-15(22-16)10-9-14(2)13-21-23(6,7)18(3,4)5/h9-12,14H,8,13H2,1-7H3/b10-9+/t14-/m1/s1 |
| InChIKey | WTXWXDOQBBCFIQ-ATWMFIQVSA-N |
| XLogP | 5.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|