C11H15NO2S — CID 169473830
ethyl 5-[3-(methylamino)prop-1-enyl]thiophene-2-carboxylate (PubChem CID 169473830) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is ethyl 5-[3-(methylamino)prop-1-enyl]thiophene-2-carboxylate.
| Compound Name | ethyl 5-[3-(methylamino)prop-1-enyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 169473830 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | ethyl 5-[3-(methylamino)prop-1-enyl]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C=CCNC)s1 |
| InChI | InChI=1S/C11H15NO2S/c1-3-14-11(13)10-7-6-9(15-10)5-4-8-12-2/h4-7,12H,3,8H2,1-2H3 |
| InChIKey | DVHBDRZFSZDTKU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |