C17H35NO4Si — CID 59470831
methyl N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,5,5-trimethyl-4-oxohexan-3-yl]carbamate (PubChem CID 59470831) has the molecular formula C17H35NO4Si and a molecular weight of 345.56 g/mol. Its IUPAC name is methyl N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,5,5-trimethyl-4-oxohexan-3-yl]carbamate.
| Compound Name | methyl N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,5,5-trimethyl-4-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 59470831 |
| Molecular Formula | C17H35NO4Si |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | methyl N-[(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2,5,5-trimethyl-4-oxohexan-3-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)C(C)(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H35NO4Si/c1-12(11-22-23(9,10)17(5,6)7)13(18-15(20)21-8)14(19)16(2,3)4/h12-13H,11H2,1-10H3,(H,18,20)/t12-,13+/m1/s1 |
| InChIKey | VHXXOMGCNAQJNW-OLZOCXBDSA-N |
| XLogP | 3.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|