C4H5NaO4S2 — CID 23692432
sodium 4-hydroxy-4-oxo-2,3-bis(sulfanyl)butanoate (PubChem CID 23692432) has the molecular formula C4H5NaO4S2 and a molecular weight of 204.20 g/mol. Its IUPAC name is sodium 4-hydroxy-4-oxo-2,3-bis(sulfanyl)butanoate.
| Compound Name | sodium 4-hydroxy-4-oxo-2,3-bis(sulfanyl)butanoate |
|---|---|
| PubChem CID | 23692432 |
| Molecular Formula | C4H5NaO4S2 |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 203.95 |
| IUPAC Name | sodium 4-hydroxy-4-oxo-2,3-bis(sulfanyl)butanoate |
| SMILES | O=C([O-])C(S)C(S)C(=O)O.[Na+] |
| InChI | InChI=1S/C4H6O4S2.Na/c5-3(6)1(9)2(10)4(7)8;/h1-2,9-10H,(H,5,6)(H,7,8);/q;+1/p-1 |
| InChIKey | BCWRXLLYMXFJDY-UHFFFAOYSA-M |
| XLogP | -4.58 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | -4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|