About trisodium;2-hydroxy-3-oxidobutanedioate
trisodium;2-hydroxy-3-oxidobutanedioate (PubChem CID 173301260) has the molecular formula C4H3Na3O6
and a molecular weight of 216.03 g/mol. Its IUPAC name is trisodium;2-hydroxy-3-oxidobutanedioate.
Molecular Properties
| Compound Name | trisodium;2-hydroxy-3-oxidobutanedioate |
| PubChem CID | 173301260 |
| Molecular Formula | C4H3Na3O6 |
| Molecular Weight | 216.03 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | trisodium;2-hydroxy-3-oxidobutanedioate |
| SMILES | O=C([O-])C([O-])C(O)C(=O)[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C4H5O6.3Na/c5-1(3(7)8)2(6)4(9)10;;;/h1-2,5H,(H,7,8)(H,9,10);;;/q-1;3*+1/p-2 |
| InChIKey | ZWRIGVNUXOGJEX-UHFFFAOYSA-L |
| XLogP | -14.41 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.03 |
| LogP ≤ 5 | -14.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze trisodium;2-hydroxy-3-oxidobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;2-hydroxy-3-oxidobutanedioate?
The IUPAC name of trisodium;2-hydroxy-3-oxidobutanedioate (CID 173301260) is trisodium;2-hydroxy-3-oxidobutanedioate.
What is the SMILES notation for trisodium;2-hydroxy-3-oxidobutanedioate?
The canonical SMILES for trisodium;2-hydroxy-3-oxidobutanedioate is O=C([O-])C([O-])C(O)C(=O)[O-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;2-hydroxy-3-oxidobutanedioate?
The InChIKey is ZWRIGVNUXOGJEX-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H5O6.3Na/c5-1(3(7)8)2(6)4(9)10;;;/h1-2,5H,(H,7,8)(H,9,10);;;/q-1;3*+1/p-2.
What are the key properties of trisodium;2-hydroxy-3-oxidobutanedioate?
trisodium;2-hydroxy-3-oxidobutanedioate has a molecular weight of 216.03 g/mol, XLogP of -14.41, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;2-hydroxy-3-oxidobutanedioate is sourced from PubChem (CID 173301260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).