C4H2BiNaO6 — CID 10249043
bismuth;sodium;2,3-dioxidobutanedioate (PubChem CID 10249043) has the molecular formula C4H2BiNaO6 and a molecular weight of 378.02 g/mol. Its IUPAC name is bismuth;sodium;2,3-dioxidobutanedioate.
| Compound Name | bismuth;sodium;2,3-dioxidobutanedioate |
|---|---|
| PubChem CID | 10249043 |
| Molecular Formula | C4H2BiNaO6 |
| Molecular Weight | 378.02 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | bismuth;sodium;2,3-dioxidobutanedioate |
| SMILES | O=C([O-])C([O-])C([O-])C(=O)[O-].[Bi+3].[Na+] |
| InChI | InChI=1S/C4H4O6.Bi.Na/c5-1(3(7)8)2(6)4(9)10;;/h1-2H,(H,7,8)(H,9,10);;/q-2;+3;+1/p-2 |
| InChIKey | YPQBHUDKOKUINZ-UHFFFAOYSA-L |
| XLogP | -9.43 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.02 |
| LogP ≤ 5 | -9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |