C4H6NaO4S2+ — CID 24812346
sodium 2,3-bis(sulfanyl)butanedioic acid (PubChem CID 24812346) has the molecular formula C4H6NaO4S2+ and a molecular weight of 205.21 g/mol. Its IUPAC name is sodium 2,3-bis(sulfanyl)butanedioic acid.
| Compound Name | sodium 2,3-bis(sulfanyl)butanedioic acid |
|---|---|
| PubChem CID | 24812346 |
| Molecular Formula | C4H6NaO4S2+ |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 204.96 |
| IUPAC Name | sodium 2,3-bis(sulfanyl)butanedioic acid |
| SMILES | O=C(O)C(S)C(S)C(=O)O.[Na+] |
| InChI | InChI=1S/C4H6O4S2.Na/c5-3(6)1(9)2(10)4(7)8;/h1-2,9-10H,(H,5,6)(H,7,8);/q;+1 |
| InChIKey | BCWRXLLYMXFJDY-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|