C6H12O2S — CID 55302342
(2R,3S)-3-methyl-2-sulfanylpentanoic acid (PubChem CID 55302342) has the molecular formula C6H12O2S and a molecular weight of 148.23 g/mol. Its IUPAC name is (2R,3S)-3-methyl-2-sulfanylpentanoic acid.
| Compound Name | (2R,3S)-3-methyl-2-sulfanylpentanoic acid |
|---|---|
| PubChem CID | 55302342 |
| Molecular Formula | C6H12O2S |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | (2R,3S)-3-methyl-2-sulfanylpentanoic acid |
| SMILES | CC[C@H](C)[C@@H](S)C(=O)O |
| InChI | InChI=1S/C6H12O2S/c1-3-4(2)5(9)6(7)8/h4-5,9H,3H2,1-2H3,(H,7,8)/t4-,5+/m0/s1 |
| InChIKey | UOXBLRPSRFKZPW-CRCLSJGQSA-N |
| XLogP | 1.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|