About 2-sulfanylbutanoic acid
2-sulfanylbutanoic acid (PubChem CID 159730662) has the molecular formula C8H16O4S2
and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-sulfanylbutanoic acid.
Molecular Properties
| Compound Name | 2-sulfanylbutanoic acid |
| PubChem CID | 159730662 |
| Molecular Formula | C8H16O4S2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-sulfanylbutanoic acid |
| SMILES | CCC(S)C(=O)O.CCC(S)C(=O)O |
| InChI | InChI=1S/2C4H8O2S/c2*1-2-3(7)4(5)6/h2*3,7H,2H2,1H3,(H,5,6) |
| InChIKey | NBERUNDDXQSTKS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylbutanoic acid?
The IUPAC name of 2-sulfanylbutanoic acid (CID 159730662) is 2-sulfanylbutanoic acid.
What is the SMILES notation for 2-sulfanylbutanoic acid?
The canonical SMILES for 2-sulfanylbutanoic acid is CCC(S)C(=O)O.CCC(S)C(=O)O.
What is the InChIKey of 2-sulfanylbutanoic acid?
The InChIKey is NBERUNDDXQSTKS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H8O2S/c2*1-2-3(7)4(5)6/h2*3,7H,2H2,1H3,(H,5,6).
What are the key properties of 2-sulfanylbutanoic acid?
2-sulfanylbutanoic acid has a molecular weight of 240.35 g/mol, XLogP of 1.56, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylbutanoic acid is sourced from PubChem (CID 159730662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).