2-sulfanylbutanoic acid

C8H16O4S2 — CID 159730662

IUPAC2-sulfanylbutanoic acid
SMILESCCC(S)C(=O)O.CCC(S)C(=O)O
InChIInChI=1S/2C4H8O2S/c2*1-2-3(7)4(5)6/h2*3,7H,2H2,1H3,(H,5,6)
InChIKeyNBERUNDDXQSTKS-UHFFFAOYSA-N
MW240.35 g/mol
LogP1.56
Rot. Bonds4

About 2-sulfanylbutanoic acid

2-sulfanylbutanoic acid (PubChem CID 159730662) has the molecular formula C8H16O4S2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-sulfanylbutanoic acid.

Molecular Properties

Compound Name2-sulfanylbutanoic acid
PubChem CID159730662
Molecular FormulaC8H16O4S2
Molecular Weight240.35 g/mol
Exact Mass240.05
IUPAC Name2-sulfanylbutanoic acid
SMILESCCC(S)C(=O)O.CCC(S)C(=O)O
InChIInChI=1S/2C4H8O2S/c2*1-2-3(7)4(5)6/h2*3,7H,2H2,1H3,(H,5,6)
InChIKeyNBERUNDDXQSTKS-UHFFFAOYSA-N
XLogP1.56
TPSA74.60 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.35
LogP ≤ 51.56
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2-sulfanylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-sulfanylbutanoic acid?
The IUPAC name of 2-sulfanylbutanoic acid (CID 159730662) is 2-sulfanylbutanoic acid.
What is the SMILES notation for 2-sulfanylbutanoic acid?
The canonical SMILES for 2-sulfanylbutanoic acid is CCC(S)C(=O)O.CCC(S)C(=O)O.
What is the InChIKey of 2-sulfanylbutanoic acid?
The InChIKey is NBERUNDDXQSTKS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H8O2S/c2*1-2-3(7)4(5)6/h2*3,7H,2H2,1H3,(H,5,6).
What are the key properties of 2-sulfanylbutanoic acid?
2-sulfanylbutanoic acid has a molecular weight of 240.35 g/mol, XLogP of 1.56, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylbutanoic acid is sourced from PubChem (CID 159730662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).