About 2-sulfanylicosanoic acid
2-sulfanylicosanoic acid (PubChem CID 18417186) has the molecular formula C20H40O2S
and a molecular weight of 344.61 g/mol. Its IUPAC name is 2-sulfanylicosanoic acid.
Molecular Properties
| Compound Name | 2-sulfanylicosanoic acid |
| PubChem CID | 18417186 |
| Molecular Formula | C20H40O2S |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 2-sulfanylicosanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCCC(S)C(=O)O |
| InChI | InChI=1S/C20H40O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(23)20(21)22/h19,23H,2-18H2,1H3,(H,21,22) |
| InChIKey | YVCHPMROVUZJDK-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylicosanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylicosanoic acid?
The IUPAC name of 2-sulfanylicosanoic acid (CID 18417186) is 2-sulfanylicosanoic acid.
What is the SMILES notation for 2-sulfanylicosanoic acid?
The canonical SMILES for 2-sulfanylicosanoic acid is CCCCCCCCCCCCCCCCCCC(S)C(=O)O.
What is the InChIKey of 2-sulfanylicosanoic acid?
The InChIKey is YVCHPMROVUZJDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(23)20(21)22/h19,23H,2-18H2,1H3,(H,21,22).
What are the key properties of 2-sulfanylicosanoic acid?
2-sulfanylicosanoic acid has a molecular weight of 344.61 g/mol, XLogP of 7.02, 18 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylicosanoic acid is sourced from PubChem (CID 18417186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).