C14H30O6S2 — CID 87208326
octane-1,1-diol;bis(2-sulfanylpropanoic acid) (PubChem CID 87208326) has the molecular formula C14H30O6S2 and a molecular weight of 358.52 g/mol. Its IUPAC name is octane-1,1-diol;bis(2-sulfanylpropanoic acid).
| Compound Name | octane-1,1-diol;bis(2-sulfanylpropanoic acid) |
|---|---|
| PubChem CID | 87208326 |
| Molecular Formula | C14H30O6S2 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | octane-1,1-diol;bis(2-sulfanylpropanoic acid) |
| SMILES | CC(S)C(=O)O.CC(S)C(=O)O.CCCCCCCC(O)O |
| InChI | InChI=1S/C8H18O2.2C3H6O2S/c1-2-3-4-5-6-7-8(9)10;2*1-2(6)3(4)5/h8-10H,2-7H2,1H3;2*2,6H,1H3,(H,4,5) |
| InChIKey | RALSMBJMIHTMKC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|