About 2-sulfanylheptanoate
2-sulfanylheptanoate (PubChem CID 22594709) has the molecular formula C7H13O2S-
and a molecular weight of 161.25 g/mol. Its IUPAC name is 2-sulfanylheptanoate.
Molecular Properties
| Compound Name | 2-sulfanylheptanoate |
| PubChem CID | 22594709 |
| Molecular Formula | C7H13O2S- |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 2-sulfanylheptanoate |
| SMILES | CCCCCC(S)C(=O)[O-] |
| InChI | InChI=1S/C7H14O2S/c1-2-3-4-5-6(10)7(8)9/h6,10H,2-5H2,1H3,(H,8,9)/p-1 |
| InChIKey | BZGHIQTWNAKSCX-UHFFFAOYSA-M |
| XLogP | 0.62 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylheptanoate?
The IUPAC name of 2-sulfanylheptanoate (CID 22594709) is 2-sulfanylheptanoate.
What is the SMILES notation for 2-sulfanylheptanoate?
The canonical SMILES for 2-sulfanylheptanoate is CCCCCC(S)C(=O)[O-].
What is the InChIKey of 2-sulfanylheptanoate?
The InChIKey is BZGHIQTWNAKSCX-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H14O2S/c1-2-3-4-5-6(10)7(8)9/h6,10H,2-5H2,1H3,(H,8,9)/p-1.
What are the key properties of 2-sulfanylheptanoate?
2-sulfanylheptanoate has a molecular weight of 161.25 g/mol, XLogP of 0.62, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylheptanoate is sourced from PubChem (CID 22594709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).