C8H15O2S2- — CID 23298468
2,8-bis(sulfanyl)octanoate (PubChem CID 23298468) has the molecular formula C8H15O2S2- and a molecular weight of 207.34 g/mol. Its IUPAC name is 2,8-bis(sulfanyl)octanoate.
| Compound Name | 2,8-bis(sulfanyl)octanoate |
|---|---|
| PubChem CID | 23298468 |
| Molecular Formula | C8H15O2S2- |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2,8-bis(sulfanyl)octanoate |
| SMILES | O=C([O-])C(S)CCCCCCS |
| InChI | InChI=1S/C8H16O2S2/c9-8(10)7(12)5-3-1-2-4-6-11/h7,11-12H,1-6H2,(H,9,10)/p-1 |
| InChIKey | AKFAIADXMBAEET-UHFFFAOYSA-M |
| XLogP | 0.92 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|