About dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate)
dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate) (PubChem CID 22483602) has the molecular formula C22H44O4S2Sn
and a molecular weight of 555.44 g/mol. Its IUPAC name is dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate).
Molecular Properties
| Compound Name | dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate) |
| PubChem CID | 22483602 |
| Molecular Formula | C22H44O4S2Sn |
| Molecular Weight | 555.44 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate) |
| SMILES | CC(C)CCCCCC(S)C(=O)[O-].CC(C)CCCCCC(S)C(=O)[O-].C[Sn+2]C |
| InChI | InChI=1S/2C10H20O2S.2CH3.Sn/c2*1-8(2)6-4-3-5-7-9(13)10(11)12;;;/h2*8-9,13H,3-7H2,1-2H3,(H,11,12);2*1H3;/q;;;;+2/p-2 |
| InChIKey | DRNPVWHEWZJIQL-UHFFFAOYSA-L |
| XLogP | 4.07 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 555.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate)?
The IUPAC name of dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate) (CID 22483602) is dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate).
What is the SMILES notation for dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate)?
The canonical SMILES for dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate) is CC(C)CCCCCC(S)C(=O)[O-].CC(C)CCCCCC(S)C(=O)[O-].C[Sn+2]C.
What is the InChIKey of dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate)?
The InChIKey is DRNPVWHEWZJIQL-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H20O2S.2CH3.Sn/c2*1-8(2)6-4-3-5-7-9(13)10(11)12;;;/h2*8-9,13H,3-7H2,1-2H3,(H,11,12);2*1H3;/q;;;;+2/p-2.
What are the key properties of dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate)?
dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate) has a molecular weight of 555.44 g/mol, XLogP of 4.07, 14 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyltin(2+);bis(8-methyl-2-sulfanylnonanoate) is sourced from PubChem (CID 22483602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).