C6H10O4S3 — CID 19891098
4-oxo-2,3-bis(sulfanyl)-4-(2-sulfanylethoxy)butanoic acid (PubChem CID 19891098) has the molecular formula C6H10O4S3 and a molecular weight of 242.34 g/mol. Its IUPAC name is 4-oxo-2,3-bis(sulfanyl)-4-(2-sulfanylethoxy)butanoic acid.
| Compound Name | 4-oxo-2,3-bis(sulfanyl)-4-(2-sulfanylethoxy)butanoic acid |
|---|---|
| PubChem CID | 19891098 |
| Molecular Formula | C6H10O4S3 |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 4-oxo-2,3-bis(sulfanyl)-4-(2-sulfanylethoxy)butanoic acid |
| SMILES | O=C(O)C(S)C(S)C(=O)OCCS |
| InChI | InChI=1S/C6H10O4S3/c7-5(8)3(12)4(13)6(9)10-1-2-11/h3-4,11-13H,1-2H2,(H,7,8) |
| InChIKey | UWFMCQSNYFEYAW-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|