C8H14O5S4 — CID 54266084
2,4-bis(sulfanyl)-3-(2-sulfanylethoxy)-3-(sulfanylmethyl)pentanedioic acid (PubChem CID 54266084) has the molecular formula C8H14O5S4 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2,4-bis(sulfanyl)-3-(2-sulfanylethoxy)-3-(sulfanylmethyl)pentanedioic acid.
| Compound Name | 2,4-bis(sulfanyl)-3-(2-sulfanylethoxy)-3-(sulfanylmethyl)pentanedioic acid |
|---|---|
| PubChem CID | 54266084 |
| Molecular Formula | C8H14O5S4 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 2,4-bis(sulfanyl)-3-(2-sulfanylethoxy)-3-(sulfanylmethyl)pentanedioic acid |
| SMILES | O=C(O)C(S)C(CS)(OCCS)C(S)C(=O)O |
| InChI | InChI=1S/C8H14O5S4/c9-6(10)4(16)8(3-15,13-1-2-14)5(17)7(11)12/h4-5,14-17H,1-3H2,(H,9,10)(H,11,12) |
| InChIKey | RGWKEJVDQZSLRL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|