C5H8I2O — CID 14977100
(2R,4S)-2,4-diiodopentan-3-one (PubChem CID 14977100) has the molecular formula C5H8I2O and a molecular weight of 337.93 g/mol. Its IUPAC name is (2R,4S)-2,4-diiodopentan-3-one.
| Compound Name | (2R,4S)-2,4-diiodopentan-3-one |
|---|---|
| PubChem CID | 14977100 |
| Molecular Formula | C5H8I2O |
| Molecular Weight | 337.93 g/mol |
| Exact Mass | 337.87 |
| IUPAC Name | (2R,4S)-2,4-diiodopentan-3-one |
| SMILES | C[C@H](I)C(=O)[C@@H](C)I |
| InChI | InChI=1S/C5H8I2O/c1-3(6)5(8)4(2)7/h3-4H,1-2H3/t3-,4+ |
| InChIKey | YXWFMIGIPJOXGJ-ZXZARUISSA-N |
| XLogP | 2.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.93 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|