About (2R,4S)-2,4-diiodopentan-3-one
(2R,4S)-2,4-diiodopentan-3-one (PubChem CID 14977100) has the molecular formula C5H8I2O
and a molecular weight of 337.93 g/mol. Its IUPAC name is (2R,4S)-2,4-diiodopentan-3-one.
Molecular Properties
| Compound Name | (2R,4S)-2,4-diiodopentan-3-one |
| PubChem CID | 14977100 |
| Molecular Formula | C5H8I2O |
| Molecular Weight | 337.93 g/mol |
| Exact Mass | 337.87 |
| IUPAC Name | (2R,4S)-2,4-diiodopentan-3-one |
| SMILES | C[C@H](I)C(=O)[C@@H](C)I |
| InChI | InChI=1S/C5H8I2O/c1-3(6)5(8)4(2)7/h3-4H,1-2H3/t3-,4+ |
| InChIKey | YXWFMIGIPJOXGJ-ZXZARUISSA-N |
| XLogP | 2.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.93 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2R,4S)-2,4-diiodopentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-2,4-diiodopentan-3-one?
The IUPAC name of (2R,4S)-2,4-diiodopentan-3-one (CID 14977100) is (2R,4S)-2,4-diiodopentan-3-one.
What is the SMILES notation for (2R,4S)-2,4-diiodopentan-3-one?
The canonical SMILES for (2R,4S)-2,4-diiodopentan-3-one is C[C@H](I)C(=O)[C@@H](C)I.
What is the InChIKey of (2R,4S)-2,4-diiodopentan-3-one?
The InChIKey is YXWFMIGIPJOXGJ-ZXZARUISSA-N. The full InChI is InChI=1S/C5H8I2O/c1-3(6)5(8)4(2)7/h3-4H,1-2H3/t3-,4+.
What are the key properties of (2R,4S)-2,4-diiodopentan-3-one?
(2R,4S)-2,4-diiodopentan-3-one has a molecular weight of 337.93 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-2,4-diiodopentan-3-one is sourced from PubChem (CID 14977100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).