C16H36N2O2 — CID 142623125
4-[2-(4,4-dimethylpentoxy)ethyl]morpholine;N-methylethanamine (PubChem CID 142623125) has the molecular formula C16H36N2O2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 4-[2-(4,4-dimethylpentoxy)ethyl]morpholine;N-methylethanamine.
| Compound Name | 4-[2-(4,4-dimethylpentoxy)ethyl]morpholine;N-methylethanamine |
|---|---|
| PubChem CID | 142623125 |
| Molecular Formula | C16H36N2O2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 4-[2-(4,4-dimethylpentoxy)ethyl]morpholine;N-methylethanamine |
| SMILES | CC(C)(C)CCCOCCN1CCOCC1.CCNC |
| InChI | InChI=1S/C13H27NO2.C3H9N/c1-13(2,3)5-4-9-15-10-6-14-7-11-16-12-8-14;1-3-4-2/h4-12H2,1-3H3;4H,3H2,1-2H3 |
| InChIKey | NUVYVJJRNJICCL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|