C16H33NO2 — CID 138647821
4-[2-(4,4,5,5-tetramethylhexoxy)ethyl]morpholine (PubChem CID 138647821) has the molecular formula C16H33NO2 and a molecular weight of 271.44 g/mol. Its IUPAC name is 4-[2-(4,4,5,5-tetramethylhexoxy)ethyl]morpholine.
| Compound Name | 4-[2-(4,4,5,5-tetramethylhexoxy)ethyl]morpholine |
|---|---|
| PubChem CID | 138647821 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 4-[2-(4,4,5,5-tetramethylhexoxy)ethyl]morpholine |
| SMILES | CC(C)(C)C(C)(C)CCCOCCN1CCOCC1 |
| InChI | InChI=1S/C16H33NO2/c1-15(2,3)16(4,5)7-6-11-18-12-8-17-9-13-19-14-10-17/h6-14H2,1-5H3 |
| InChIKey | LLULYQQEGGJCCT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|