C20H41NO2 — CID 158651768
(2S)-4-[2-(4,4-dimethylpentoxy)ethyl]-2-(4,4-dimethylpentyl)morpholine (PubChem CID 158651768) has the molecular formula C20H41NO2 and a molecular weight of 327.55 g/mol. Its IUPAC name is (2S)-4-[2-(4,4-dimethylpentoxy)ethyl]-2-(4,4-dimethylpentyl)morpholine.
| Compound Name | (2S)-4-[2-(4,4-dimethylpentoxy)ethyl]-2-(4,4-dimethylpentyl)morpholine |
|---|---|
| PubChem CID | 158651768 |
| Molecular Formula | C20H41NO2 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 327.31 |
| IUPAC Name | (2S)-4-[2-(4,4-dimethylpentoxy)ethyl]-2-(4,4-dimethylpentyl)morpholine |
| SMILES | CC(C)(C)CCCOCCN1CCO[C@@H](CCCC(C)(C)C)C1 |
| InChI | InChI=1S/C20H41NO2/c1-19(2,3)10-7-9-18-17-21(13-16-23-18)12-15-22-14-8-11-20(4,5)6/h18H,7-17H2,1-6H3/t18-/m0/s1 |
| InChIKey | IBQJOHWFOFCBQJ-SFHVURJKSA-N |
| XLogP | 4.75 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|