C25H50N2O3 — CID 166800924
N-[[4-[2-(4,4-dimethylpentoxy)ethyl]morpholin-2-yl]methyl]-2-ethyl-2-methyloctanamide (PubChem CID 166800924) has the molecular formula C25H50N2O3 and a molecular weight of 426.69 g/mol. Its IUPAC name is N-[[4-[2-(4,4-dimethylpentoxy)ethyl]morpholin-2-yl]methyl]-2-ethyl-2-methyloctanamide.
| Compound Name | N-[[4-[2-(4,4-dimethylpentoxy)ethyl]morpholin-2-yl]methyl]-2-ethyl-2-methyloctanamide |
|---|---|
| PubChem CID | 166800924 |
| Molecular Formula | C25H50N2O3 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.38 |
| IUPAC Name | N-[[4-[2-(4,4-dimethylpentoxy)ethyl]morpholin-2-yl]methyl]-2-ethyl-2-methyloctanamide |
| SMILES | CCCCCCC(C)(CC)C(=O)NCC1CN(CCOCCCC(C)(C)C)CCO1 |
| InChI | InChI=1S/C25H50N2O3/c1-7-9-10-11-14-25(6,8-2)23(28)26-20-22-21-27(16-19-30-22)15-18-29-17-12-13-24(3,4)5/h22H,7-21H2,1-6H3,(H,26,28) |
| InChIKey | BTQOHZRMYPSWTG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|