C28H57N3O3 — CID 170250635
2-ethyl-2-methyl-N-[2-[2-[2-[4-(2-methylhexan-2-yl)piperazin-1-yl]ethoxy]ethoxy]ethyl]octanamide (PubChem CID 170250635) has the molecular formula C28H57N3O3 and a molecular weight of 483.78 g/mol. Its IUPAC name is 2-ethyl-2-methyl-N-[2-[2-[2-[4-(2-methylhexan-2-yl)piperazin-1-yl]ethoxy]ethoxy]ethyl]octanamide.
| Compound Name | 2-ethyl-2-methyl-N-[2-[2-[2-[4-(2-methylhexan-2-yl)piperazin-1-yl]ethoxy]ethoxy]ethyl]octanamide |
|---|---|
| PubChem CID | 170250635 |
| Molecular Formula | C28H57N3O3 |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 483.44 |
| IUPAC Name | 2-ethyl-2-methyl-N-[2-[2-[2-[4-(2-methylhexan-2-yl)piperazin-1-yl]ethoxy]ethoxy]ethyl]octanamide |
| SMILES | CCCCCCC(C)(CC)C(=O)NCCOCCOCCN1CCN(C(C)(C)CCCC)CC1 |
| InChI | InChI=1S/C28H57N3O3/c1-7-10-12-13-15-28(6,9-3)26(32)29-16-22-33-24-25-34-23-21-30-17-19-31(20-18-30)27(4,5)14-11-8-2/h7-25H2,1-6H3,(H,29,32) |
| InChIKey | UUEAHSUHYGDNNL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|