C22H44N2O3 — CID 170091257
N-[[(2R)-4-[2-(4,4-dimethylheptoxy)ethyl]morpholin-2-yl]methyl]-2-methylpentanamide (PubChem CID 170091257) has the molecular formula C22H44N2O3 and a molecular weight of 384.61 g/mol. Its IUPAC name is N-[[(2R)-4-[2-(4,4-dimethylheptoxy)ethyl]morpholin-2-yl]methyl]-2-methylpentanamide.
| Compound Name | N-[[(2R)-4-[2-(4,4-dimethylheptoxy)ethyl]morpholin-2-yl]methyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 170091257 |
| Molecular Formula | C22H44N2O3 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.34 |
| IUPAC Name | N-[[(2R)-4-[2-(4,4-dimethylheptoxy)ethyl]morpholin-2-yl]methyl]-2-methylpentanamide |
| SMILES | CCCC(C)C(=O)NC[C@@H]1CN(CCOCCCC(C)(C)CCC)CCO1 |
| InChI | InChI=1S/C22H44N2O3/c1-6-9-19(3)21(25)23-17-20-18-24(13-16-27-20)12-15-26-14-8-11-22(4,5)10-7-2/h19-20H,6-18H2,1-5H3,(H,23,25)/t19?,20-/m1/s1 |
| InChIKey | GKXYUPVAUYKEJZ-GFOWMXPYSA-N |
| XLogP | 3.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|