C23H48N2O2 — CID 166800930
N-[[4-[2-(4,4-dimethylheptoxy)ethyl]morpholin-2-yl]methyl]-2-ethyl-2-methylbutan-1-amine (PubChem CID 166800930) has the molecular formula C23H48N2O2 and a molecular weight of 384.65 g/mol. Its IUPAC name is N-[[4-[2-(4,4-dimethylheptoxy)ethyl]morpholin-2-yl]methyl]-2-ethyl-2-methylbutan-1-amine.
| Compound Name | N-[[4-[2-(4,4-dimethylheptoxy)ethyl]morpholin-2-yl]methyl]-2-ethyl-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 166800930 |
| Molecular Formula | C23H48N2O2 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 384.37 |
| IUPAC Name | N-[[4-[2-(4,4-dimethylheptoxy)ethyl]morpholin-2-yl]methyl]-2-ethyl-2-methylbutan-1-amine |
| SMILES | CCCC(C)(C)CCCOCCN1CCOC(CNCC(C)(CC)CC)C1 |
| InChI | InChI=1S/C23H48N2O2/c1-7-11-22(4,5)12-10-15-26-16-13-25-14-17-27-21(19-25)18-24-20-23(6,8-2)9-3/h21,24H,7-20H2,1-6H3 |
| InChIKey | AQPBQOJZEGWMDG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|