C18H38N2O2 — CID 138727616
N-[[(2S)-4-[2-(4,4-dimethylpentoxy)ethyl]morpholin-2-yl]methyl]-2-methylpropan-1-amine (PubChem CID 138727616) has the molecular formula C18H38N2O2 and a molecular weight of 314.51 g/mol. Its IUPAC name is N-[[(2S)-4-[2-(4,4-dimethylpentoxy)ethyl]morpholin-2-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[(2S)-4-[2-(4,4-dimethylpentoxy)ethyl]morpholin-2-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 138727616 |
| Molecular Formula | C18H38N2O2 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.29 |
| IUPAC Name | N-[[(2S)-4-[2-(4,4-dimethylpentoxy)ethyl]morpholin-2-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNC[C@H]1CN(CCOCCCC(C)(C)C)CCO1 |
| InChI | InChI=1S/C18H38N2O2/c1-16(2)13-19-14-17-15-20(9-12-22-17)8-11-21-10-6-7-18(3,4)5/h16-17,19H,6-15H2,1-5H3/t17-/m0/s1 |
| InChIKey | LXDYJJRUOLXKBA-KRWDZBQOSA-N |
| XLogP | 2.78 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|