C19H42N2O2 — CID 176933389
ethane;2-methyl-N-[[4-[2-(4-methylpentoxy)ethyl]morpholin-2-yl]methyl]propan-1-amine (PubChem CID 176933389) has the molecular formula C19H42N2O2 and a molecular weight of 330.56 g/mol. Its IUPAC name is ethane;2-methyl-N-[[4-[2-(4-methylpentoxy)ethyl]morpholin-2-yl]methyl]propan-1-amine.
| Compound Name | ethane;2-methyl-N-[[4-[2-(4-methylpentoxy)ethyl]morpholin-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 176933389 |
| Molecular Formula | C19H42N2O2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.32 |
| IUPAC Name | ethane;2-methyl-N-[[4-[2-(4-methylpentoxy)ethyl]morpholin-2-yl]methyl]propan-1-amine |
| SMILES | CC.CC(C)CCCOCCN1CCOC(CNCC(C)C)C1 |
| InChI | InChI=1S/C17H36N2O2.C2H6/c1-15(2)6-5-9-20-10-7-19-8-11-21-17(14-19)13-18-12-16(3)4;1-2/h15-18H,5-14H2,1-4H3;1-2H3 |
| InChIKey | CPUFUZZDZOLCFV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|