C19H42N2O3 — CID 155582545
N-methylformamide;2-methyl-4-[2-(4-methylpentoxy)ethyl]morpholine;2-methylpropane (PubChem CID 155582545) has the molecular formula C19H42N2O3 and a molecular weight of 346.56 g/mol. Its IUPAC name is N-methylformamide;2-methyl-4-[2-(4-methylpentoxy)ethyl]morpholine;2-methylpropane.
| Compound Name | N-methylformamide;2-methyl-4-[2-(4-methylpentoxy)ethyl]morpholine;2-methylpropane |
|---|---|
| PubChem CID | 155582545 |
| Molecular Formula | C19H42N2O3 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | N-methylformamide;2-methyl-4-[2-(4-methylpentoxy)ethyl]morpholine;2-methylpropane |
| SMILES | CC(C)C.CC(C)CCCOCCN1CCOC(C)C1.CNC=O |
| InChI | InChI=1S/C13H27NO2.C4H10.C2H5NO/c1-12(2)5-4-8-15-9-6-14-7-10-16-13(3)11-14;1-4(2)3;1-3-2-4/h12-13H,4-11H2,1-3H3;4H,1-3H3;2H,1H3,(H,3,4) |
| InChIKey | ILAJXIWYPJFTRL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|