C22H48N2O4 — CID 154661250
ethane;4-(2-ethoxyethyl)-2,6-dimethylmorpholine;(2S)-2-methyl-4-(2-propoxyethyl)morpholine (PubChem CID 154661250) has the molecular formula C22H48N2O4 and a molecular weight of 404.64 g/mol. Its IUPAC name is ethane;4-(2-ethoxyethyl)-2,6-dimethylmorpholine;(2S)-2-methyl-4-(2-propoxyethyl)morpholine.
| Compound Name | ethane;4-(2-ethoxyethyl)-2,6-dimethylmorpholine;(2S)-2-methyl-4-(2-propoxyethyl)morpholine |
|---|---|
| PubChem CID | 154661250 |
| Molecular Formula | C22H48N2O4 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.36 |
| IUPAC Name | ethane;4-(2-ethoxyethyl)-2,6-dimethylmorpholine;(2S)-2-methyl-4-(2-propoxyethyl)morpholine |
| SMILES | CC.CCCOCCN1CCO[C@@H](C)C1.CCOCCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/2C10H21NO2.C2H6/c1-4-12-6-5-11-7-9(2)13-10(3)8-11;1-3-6-12-7-4-11-5-8-13-10(2)9-11;1-2/h9-10H,4-8H2,1-3H3;10H,3-9H2,1-2H3;1-2H3/t;10-;/m.0./s1 |
| InChIKey | RGQWPXYLNUAAEV-RBPNCNDUSA-N |
| XLogP | 3.29 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|