About ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine
ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine (PubChem CID 154661350) has the molecular formula C13H29NO2
and a molecular weight of 231.38 g/mol. Its IUPAC name is ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine.
Molecular Properties
| Compound Name | ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine |
| PubChem CID | 154661350 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine |
| SMILES | C=C.CC.COCCCN1CCO[C@@H](C)C1 |
| InChI | InChI=1S/C9H19NO2.C2H6.C2H4/c1-9-8-10(5-7-12-9)4-3-6-11-2;2*1-2/h9H,3-8H2,1-2H3;1-2H3;1-2H2/t9-;;/m0../s1 |
| InChIKey | LUOKKOASBNEHIT-WWPIYYJJSA-N |
| XLogP | 2.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine?
The IUPAC name of ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine (CID 154661350) is ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine.
What is the SMILES notation for ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine?
The canonical SMILES for ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine is C=C.CC.COCCCN1CCO[C@@H](C)C1.
What is the InChIKey of ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine?
The InChIKey is LUOKKOASBNEHIT-WWPIYYJJSA-N. The full InChI is InChI=1S/C9H19NO2.C2H6.C2H4/c1-9-8-10(5-7-12-9)4-3-6-11-2;2*1-2/h9H,3-8H2,1-2H3;1-2H3;1-2H2/t9-;;/m0../s1.
What are the key properties of ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine?
ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine has a molecular weight of 231.38 g/mol, XLogP of 2.57, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;(2S)-4-(3-methoxypropyl)-2-methylmorpholine is sourced from PubChem (CID 154661350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).