C13H26N2O3 — CID 156795250
N-[[4-(2-pentoxyethyl)morpholin-2-yl]methyl]formamide (PubChem CID 156795250) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is N-[[4-(2-pentoxyethyl)morpholin-2-yl]methyl]formamide.
| Compound Name | N-[[4-(2-pentoxyethyl)morpholin-2-yl]methyl]formamide |
|---|---|
| PubChem CID | 156795250 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | N-[[4-(2-pentoxyethyl)morpholin-2-yl]methyl]formamide |
| SMILES | CCCCCOCCN1CCOC(CNC=O)C1 |
| InChI | InChI=1S/C13H26N2O3/c1-2-3-4-7-17-8-5-15-6-9-18-13(11-15)10-14-12-16/h12-13H,2-11H2,1H3,(H,14,16) |
| InChIKey | AYACLZOXZXJJNA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|