C22H45N3O3 — CID 170249660
2,2-dimethyl-N-[[4-[2-[2-(3-methylhexan-3-ylamino)ethoxy]ethyl]morpholin-2-yl]methyl]butanamide (PubChem CID 170249660) has the molecular formula C22H45N3O3 and a molecular weight of 399.62 g/mol. Its IUPAC name is 2,2-dimethyl-N-[[4-[2-[2-(3-methylhexan-3-ylamino)ethoxy]ethyl]morpholin-2-yl]methyl]butanamide.
| Compound Name | 2,2-dimethyl-N-[[4-[2-[2-(3-methylhexan-3-ylamino)ethoxy]ethyl]morpholin-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 170249660 |
| Molecular Formula | C22H45N3O3 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.35 |
| IUPAC Name | 2,2-dimethyl-N-[[4-[2-[2-(3-methylhexan-3-ylamino)ethoxy]ethyl]morpholin-2-yl]methyl]butanamide |
| SMILES | CCCC(C)(CC)NCCOCCN1CCOC(CNC(=O)C(C)(C)CC)C1 |
| InChI | InChI=1S/C22H45N3O3/c1-7-10-22(6,9-3)24-11-14-27-15-12-25-13-16-28-19(18-25)17-23-20(26)21(4,5)8-2/h19,24H,7-18H2,1-6H3,(H,23,26) |
| InChIKey | MFJJFCHTXJIVRR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|