C14H29N3O3S — CID 138727912
S-methyl N-[[4-[2-[2-(propan-2-ylamino)ethoxy]ethyl]morpholin-2-yl]methyl]carbamothioate (PubChem CID 138727912) has the molecular formula C14H29N3O3S and a molecular weight of 319.47 g/mol. Its IUPAC name is S-methyl N-[[4-[2-[2-(propan-2-ylamino)ethoxy]ethyl]morpholin-2-yl]methyl]carbamothioate.
| Compound Name | S-methyl N-[[4-[2-[2-(propan-2-ylamino)ethoxy]ethyl]morpholin-2-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 138727912 |
| Molecular Formula | C14H29N3O3S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | S-methyl N-[[4-[2-[2-(propan-2-ylamino)ethoxy]ethyl]morpholin-2-yl]methyl]carbamothioate |
| SMILES | CSC(=O)NCC1CN(CCOCCNC(C)C)CCO1 |
| InChI | InChI=1S/C14H29N3O3S/c1-12(2)15-4-7-19-8-5-17-6-9-20-13(11-17)10-16-14(18)21-3/h12-13,15H,4-11H2,1-3H3,(H,16,18) |
| InChIKey | IQPNXUCHKZHFGS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|