C20H43N3O3 — CID 169019370
2,2-dimethyl-N-[2-[2-[2-[2-(4-propan-2-ylpiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]propan-1-amine (PubChem CID 169019370) has the molecular formula C20H43N3O3 and a molecular weight of 373.58 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[2-[2-[2-(4-propan-2-ylpiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]propan-1-amine.
| Compound Name | 2,2-dimethyl-N-[2-[2-[2-[2-(4-propan-2-ylpiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 169019370 |
| Molecular Formula | C20H43N3O3 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | 2,2-dimethyl-N-[2-[2-[2-[2-(4-propan-2-ylpiperazin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]propan-1-amine |
| SMILES | CC(C)N1CCN(CCOCCOCCOCCNCC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H43N3O3/c1-19(2)23-9-7-22(8-10-23)11-13-25-15-17-26-16-14-24-12-6-21-18-20(3,4)5/h19,21H,6-18H2,1-5H3 |
| InChIKey | PVDWUAZMBFFWCD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|