C19H40IN3O3 — CID 146332058
2-iodo-N-[2-[2-[2-[4-[2-[(2-methylpropan-2-yl)oxy]ethyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]propan-2-amine (PubChem CID 146332058) has the molecular formula C19H40IN3O3 and a molecular weight of 485.45 g/mol. Its IUPAC name is 2-iodo-N-[2-[2-[2-[4-[2-[(2-methylpropan-2-yl)oxy]ethyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]propan-2-amine.
| Compound Name | 2-iodo-N-[2-[2-[2-[4-[2-[(2-methylpropan-2-yl)oxy]ethyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 146332058 |
| Molecular Formula | C19H40IN3O3 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 2-iodo-N-[2-[2-[2-[4-[2-[(2-methylpropan-2-yl)oxy]ethyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]propan-2-amine |
| SMILES | CC(C)(I)NCCOCCOCCN1CCN(CCOC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H40IN3O3/c1-18(2,3)26-15-12-23-9-7-22(8-10-23)11-14-25-17-16-24-13-6-21-19(4,5)20/h21H,6-17H2,1-5H3 |
| InChIKey | FPUCNRCONDVLOS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|