C20H41N — CID 152833336
3-tert-butyl-1-(8,8-dimethylnonyl)piperidine (PubChem CID 152833336) has the molecular formula C20H41N and a molecular weight of 295.56 g/mol. Its IUPAC name is 3-tert-butyl-1-(8,8-dimethylnonyl)piperidine.
| Compound Name | 3-tert-butyl-1-(8,8-dimethylnonyl)piperidine |
|---|---|
| PubChem CID | 152833336 |
| Molecular Formula | C20H41N |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 295.32 |
| IUPAC Name | 3-tert-butyl-1-(8,8-dimethylnonyl)piperidine |
| SMILES | CC(C)(C)CCCCCCCN1CCCC(C(C)(C)C)C1 |
| InChI | InChI=1S/C20H41N/c1-19(2,3)14-10-8-7-9-11-15-21-16-12-13-18(17-21)20(4,5)6/h18H,7-17H2,1-6H3 |
| InChIKey | SWQTWLHFWACRON-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|