C11H20F3N — CID 58573528
(3R)-3-tert-butyl-1-(2,2,2-trifluoroethyl)piperidine (PubChem CID 58573528) has the molecular formula C11H20F3N and a molecular weight of 223.28 g/mol. Its IUPAC name is (3R)-3-tert-butyl-1-(2,2,2-trifluoroethyl)piperidine.
| Compound Name | (3R)-3-tert-butyl-1-(2,2,2-trifluoroethyl)piperidine |
|---|---|
| PubChem CID | 58573528 |
| Molecular Formula | C11H20F3N |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | (3R)-3-tert-butyl-1-(2,2,2-trifluoroethyl)piperidine |
| SMILES | CC(C)(C)[C@H]1CCCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C11H20F3N/c1-10(2,3)9-5-4-6-15(7-9)8-11(12,13)14/h9H,4-8H2,1-3H3/t9-/m0/s1 |
| InChIKey | BBFXGFMRLYVFJU-VIFPVBQESA-N |
| XLogP | 3.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |