C9H18F2N2 — CID 129499448
2-[(3S)-3-(1,1-difluoroethyl)piperidin-1-yl]ethanamine (PubChem CID 129499448) has the molecular formula C9H18F2N2 and a molecular weight of 192.25 g/mol. Its IUPAC name is 2-[(3S)-3-(1,1-difluoroethyl)piperidin-1-yl]ethanamine.
| Compound Name | 2-[(3S)-3-(1,1-difluoroethyl)piperidin-1-yl]ethanamine |
|---|---|
| PubChem CID | 129499448 |
| Molecular Formula | C9H18F2N2 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2-[(3S)-3-(1,1-difluoroethyl)piperidin-1-yl]ethanamine |
| SMILES | CC(F)(F)[C@H]1CCCN(CCN)C1 |
| InChI | InChI=1S/C9H18F2N2/c1-9(10,11)8-3-2-5-13(7-8)6-4-12/h8H,2-7,12H2,1H3/t8-/m0/s1 |
| InChIKey | SJDHQAGNVGDISJ-QMMMGPOBSA-N |
| XLogP | 1.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |