C9H16F2N4 — CID 121202516
1-(2-azidoethyl)-3-(1,1-difluoroethyl)piperidine (PubChem CID 121202516) has the molecular formula C9H16F2N4 and a molecular weight of 218.25 g/mol. Its IUPAC name is 1-(2-azidoethyl)-3-(1,1-difluoroethyl)piperidine.
| Compound Name | 1-(2-azidoethyl)-3-(1,1-difluoroethyl)piperidine |
|---|---|
| PubChem CID | 121202516 |
| Molecular Formula | C9H16F2N4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-(2-azidoethyl)-3-(1,1-difluoroethyl)piperidine |
| SMILES | CC(F)(F)C1CCCN(CCN=[N+]=[N-])C1 |
| InChI | InChI=1S/C9H16F2N4/c1-9(10,11)8-3-2-5-15(7-8)6-4-13-14-12/h8H,2-7H2,1H3 |
| InChIKey | IPBUMHKYTNMLOI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|