C10H17F2NO2 — CID 121202511
3-[3-(1,1-difluoroethyl)piperidin-1-yl]propanoic acid (PubChem CID 121202511) has the molecular formula C10H17F2NO2 and a molecular weight of 221.25 g/mol. Its IUPAC name is 3-[3-(1,1-difluoroethyl)piperidin-1-yl]propanoic acid.
| Compound Name | 3-[3-(1,1-difluoroethyl)piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 121202511 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-[3-(1,1-difluoroethyl)piperidin-1-yl]propanoic acid |
| SMILES | CC(F)(F)C1CCCN(CCC(=O)O)C1 |
| InChI | InChI=1S/C10H17F2NO2/c1-10(11,12)8-3-2-5-13(7-8)6-4-9(14)15/h8H,2-7H2,1H3,(H,14,15) |
| InChIKey | SVVRJYFMOBOUKB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |